C19H13N3O3S2 — CID 141166668
2-[2-[(Z)-[5-(naphthalen-2-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 141166668) has the molecular formula C19H13N3O3S2 and a molecular weight of 395.47 g/mol. Its IUPAC name is 2-[2-[(Z)-[5-(naphthalen-2-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[(Z)-[5-(naphthalen-2-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 141166668 |
| Molecular Formula | C19H13N3O3S2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 2-[2-[(Z)-[5-(naphthalen-2-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(/N=C2/NC(=O)C(=Cc3ccc4ccccc4c3)S2)n1 |
| InChI | InChI=1S/C19H13N3O3S2/c23-16(24)9-14-10-26-18(20-14)22-19-21-17(25)15(27-19)8-11-5-6-12-3-1-2-4-13(12)7-11/h1-8,10H,9H2,(H,23,24)(H,20,21,22,25) |
| InChIKey | YSPZFKBTNOWLBC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|