C21H16N4O4S — CID 135643689
(5Z)-2-(1,3-benzodioxol-5-ylimino)-5-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 135643689) has the molecular formula C21H16N4O4S and a molecular weight of 420.45 g/mol. Its IUPAC name is (5Z)-2-(1,3-benzodioxol-5-ylimino)-5-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(1,3-benzodioxol-5-ylimino)-5-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135643689 |
| Molecular Formula | C21H16N4O4S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | (5Z)-2-(1,3-benzodioxol-5-ylimino)-5-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(-c2[nH]ncc2/C=C2\S/C(=N/c3ccc4c(c3)OCO4)NC2=O)cc1 |
| InChI | InChI=1S/C21H16N4O4S/c1-27-15-5-2-12(3-6-15)19-13(10-22-25-19)8-18-20(26)24-21(30-18)23-14-4-7-16-17(9-14)29-11-28-16/h2-10H,11H2,1H3,(H,22,25)(H,23,24,26)/b18-8- |
| InChIKey | CXGUYKMUWREIGL-LSCVHKIXSA-N |
| XLogP | 3.71 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|