C19H14Cl2N2O4S — CID 137173256
(5E)-2-(3,4-dichlorophenyl)imino-5-[(6-ethoxy-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137173256) has the molecular formula C19H14Cl2N2O4S and a molecular weight of 437.30 g/mol. Its IUPAC name is (5E)-2-(3,4-dichlorophenyl)imino-5-[(6-ethoxy-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(3,4-dichlorophenyl)imino-5-[(6-ethoxy-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137173256 |
| Molecular Formula | C19H14Cl2N2O4S |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | (5E)-2-(3,4-dichlorophenyl)imino-5-[(6-ethoxy-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc2c(cc1/C=C1/S/C(=N\c3ccc(Cl)c(Cl)c3)NC1=O)OCO2 |
| InChI | InChI=1S/C19H14Cl2N2O4S/c1-2-25-14-8-16-15(26-9-27-16)5-10(14)6-17-18(24)23-19(28-17)22-11-3-4-12(20)13(21)7-11/h3-8H,2,9H2,1H3,(H,22,23,24)/b17-6+ |
| InChIKey | XGLSVNVPDDDGHO-UBKPWBPPSA-N |
| XLogP | 5.01 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|