C18H12Cl2N2O4S — CID 137076500
(5E)-2-(3,4-dichlorophenyl)imino-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137076500) has the molecular formula C18H12Cl2N2O4S and a molecular weight of 423.28 g/mol. Its IUPAC name is (5E)-2-(3,4-dichlorophenyl)imino-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(3,4-dichlorophenyl)imino-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137076500 |
| Molecular Formula | C18H12Cl2N2O4S |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | (5E)-2-(3,4-dichlorophenyl)imino-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc2c(cc1/C=C1/S/C(=N\c3ccc(Cl)c(Cl)c3)NC1=O)OCO2 |
| InChI | InChI=1S/C18H12Cl2N2O4S/c1-24-13-7-15-14(25-8-26-15)4-9(13)5-16-17(23)22-18(27-16)21-10-2-3-11(19)12(20)6-10/h2-7H,8H2,1H3,(H,21,22,23)/b16-5+ |
| InChIKey | DEXLADWJIQCWPJ-FZSIALSZSA-N |
| XLogP | 4.62 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|