C16H14N4OS2 — CID 137068891
5-[(2-amino-1,3-thiazol-5-yl)methylidene]-2-(2,3-dihydro-1H-inden-4-ylimino)-1,3-thiazolidin-4-one (PubChem CID 137068891) has the molecular formula C16H14N4OS2 and a molecular weight of 342.45 g/mol. Its IUPAC name is 5-[(2-amino-1,3-thiazol-5-yl)methylidene]-2-(2,3-dihydro-1H-inden-4-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | 5-[(2-amino-1,3-thiazol-5-yl)methylidene]-2-(2,3-dihydro-1H-inden-4-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137068891 |
| Molecular Formula | C16H14N4OS2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 5-[(2-amino-1,3-thiazol-5-yl)methylidene]-2-(2,3-dihydro-1H-inden-4-ylimino)-1,3-thiazolidin-4-one |
| SMILES | Nc1ncc(C=C2S/C(=N\c3cccc4c3CCC4)NC2=O)s1 |
| InChI | InChI=1S/C16H14N4OS2/c17-15-18-8-10(22-15)7-13-14(21)20-16(23-13)19-12-6-2-4-9-3-1-5-11(9)12/h2,4,6-8H,1,3,5H2,(H2,17,18)(H,19,20,21) |
| InChIKey | OVDJOHQGIHGDMZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|