C17H15Cl2F2N5O2 — CID 137120334
5-(3,4-dichlorophenoxy)-4-(1,1-difluorobut-2-enyl)-2-(4,5-dihydro-1H-imidazol-2-ylamino)-1H-pyrimidin-6-one (PubChem CID 137120334) has the molecular formula C17H15Cl2F2N5O2 and a molecular weight of 430.24 g/mol. Its IUPAC name is 5-(3,4-dichlorophenoxy)-4-(1,1-difluorobut-2-enyl)-2-(4,5-dihydro-1H-imidazol-2-ylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-(3,4-dichlorophenoxy)-4-(1,1-difluorobut-2-enyl)-2-(4,5-dihydro-1H-imidazol-2-ylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137120334 |
| Molecular Formula | C17H15Cl2F2N5O2 |
| Molecular Weight | 430.24 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 5-(3,4-dichlorophenoxy)-4-(1,1-difluorobut-2-enyl)-2-(4,5-dihydro-1H-imidazol-2-ylamino)-1H-pyrimidin-6-one |
| SMILES | CC=CC(F)(F)c1nc(NC2=NCCN2)[nH]c(=O)c1Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H15Cl2F2N5O2/c1-2-5-17(20,21)13-12(28-9-3-4-10(18)11(19)8-9)14(27)25-16(24-13)26-15-22-6-7-23-15/h2-5,8H,6-7H2,1H3,(H3,22,23,24,25,26,27) |
| InChIKey | UZLJUNKVCNXFED-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.24 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|