C22H25N7O2S — CID 137121656
N'-diazenyl-3-[[2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]amino]propanimidamide (PubChem CID 137121656) has the molecular formula C22H25N7O2S and a molecular weight of 451.56 g/mol. Its IUPAC name is N'-diazenyl-3-[[2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]amino]propanimidamide.
| Compound Name | N'-diazenyl-3-[[2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]amino]propanimidamide |
|---|---|
| PubChem CID | 137121656 |
| Molecular Formula | C22H25N7O2S |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N'-diazenyl-3-[[2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]amino]propanimidamide |
| SMILES | [H]/N=N/N=C(N)CCNc1cc(N2CCS(=O)(=O)c3ccccc3C2)nc2ccc(C)cc12 |
| InChI | InChI=1S/C22H25N7O2S/c1-15-6-7-18-17(12-15)19(25-9-8-21(23)27-28-24)13-22(26-18)29-10-11-32(30,31)20-5-3-2-4-16(20)14-29/h2-7,12-13H,8-11,14H2,1H3,(H,25,26)(H3,23,24,27) |
| InChIKey | NADDDTPHOMMQDY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 136.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|