C23H25N5O3S — CID 71255817
(4R)-4-[[[2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]amino]methyl]-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 71255817) has the molecular formula C23H25N5O3S and a molecular weight of 451.55 g/mol. Its IUPAC name is (4R)-4-[[[2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]amino]methyl]-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | (4R)-4-[[[2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]amino]methyl]-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 71255817 |
| Molecular Formula | C23H25N5O3S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | (4R)-4-[[[2-(1,1-dioxo-3,5-dihydro-2H-1λ6,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]amino]methyl]-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | Cc1ccc2nc(N3CCS(=O)(=O)c4ccccc4C3)cc(NC[C@@H]3COC(N)=N3)c2c1 |
| InChI | InChI=1S/C23H25N5O3S/c1-15-6-7-19-18(10-15)20(25-12-17-14-31-23(24)26-17)11-22(27-19)28-8-9-32(29,30)21-5-3-2-4-16(21)13-28/h2-7,10-11,17H,8-9,12-14H2,1H3,(H2,24,26)(H,25,27)/t17-/m1/s1 |
| InChIKey | UXNCGUVJUZTCFE-QGZVFWFLSA-N |
| XLogP | 2.46 |
| TPSA | 109.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |