C20H21FN9O11P — CID 137123189
[(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] [(1R,3R,4R,5S)-4-fluoro-5-hydroxy-3-(6-oxo-1H-purin-9-yl)-2-oxabicyclo[3.1.0]hexan-6-yl] hydrogen phosphate (PubChem CID 137123189) has the molecular formula C20H21FN9O11P and a molecular weight of 613.41 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] [(1R,3R,4R,5S)-4-fluoro-5-hydroxy-3-(6-oxo-1H-purin-9-yl)-2-oxabicyclo[3.1.0]hexan-6-yl] hydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] [(1R,3R,4R,5S)-4-fluoro-5-hydroxy-3-(6-oxo-1H-purin-9-yl)-2-oxabicyclo[3.1.0]hexan-6-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 137123189 |
| Molecular Formula | C20H21FN9O11P |
| Molecular Weight | 613.41 g/mol |
| Exact Mass | 613.11 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] [(1R,3R,4R,5S)-4-fluoro-5-hydroxy-3-(6-oxo-1H-purin-9-yl)-2-oxabicyclo[3.1.0]hexan-6-yl] hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2OP(=O)(O)OC2[C@H]3O[C@@H](n4cnc5c(=O)[nH]cnc54)[C@H](F)[C@@]23O)c(=O)[nH]1 |
| InChI | InChI=1S/C20H21FN9O11P/c21-10-18(29-3-25-6-13(29)23-2-24-15(6)33)39-11-12(20(10,11)35)41-42(36,37)40-9-8(32)5(1-31)38-17(9)30-4-26-7-14(30)27-19(22)28-16(7)34/h2-5,8-12,17-18,31-32,35H,1H2,(H,36,37)(H,23,24,33)(H3,22,27,28,34)/t5-,8-,9-,10+,11-,12?,17-,18-,20+/m1/s1 |
| InChIKey | XBXNLRVPRLNKFE-UXZFYQAGSA-N |
| XLogP | -3.06 |
| TPSA | 288.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.41 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|