C20H21N12O11P — CID 137123391
[(1S,3R)-3-(2-amino-6-oxo-1H-purin-9-yl)-5-azido-6-hydroxy-2-oxabicyclo[3.1.0]hexan-4-yl] [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl hydrogen phosphate (PubChem CID 137123391) has the molecular formula C20H21N12O11P and a molecular weight of 636.44 g/mol. Its IUPAC name is [(1S,3R)-3-(2-amino-6-oxo-1H-purin-9-yl)-5-azido-6-hydroxy-2-oxabicyclo[3.1.0]hexan-4-yl] [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(1S,3R)-3-(2-amino-6-oxo-1H-purin-9-yl)-5-azido-6-hydroxy-2-oxabicyclo[3.1.0]hexan-4-yl] [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 137123391 |
| Molecular Formula | C20H21N12O11P |
| Molecular Weight | 636.44 g/mol |
| Exact Mass | 636.12 |
| IUPAC Name | [(1S,3R)-3-(2-amino-6-oxo-1H-purin-9-yl)-5-azido-6-hydroxy-2-oxabicyclo[3.1.0]hexan-4-yl] [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl hydrogen phosphate |
| SMILES | [N-]=[N+]=NC12C(O)C1O[C@@H](n1cnc3c(=O)[nH]c(N)nc31)C2OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]cnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H21N12O11P/c21-19-27-14-7(16(37)28-19)26-4-32(14)18-12(20(29-30-22)10(35)11(20)42-18)43-44(38,39)40-1-5-8(33)9(34)17(41-5)31-3-25-6-13(31)23-2-24-15(6)36/h2-5,8-12,17-18,33-35H,1H2,(H,38,39)(H,23,24,36)(H3,21,27,28,37)/t5-,8-,9-,10?,11?,12?,17-,18-,20?/m1/s1 |
| InChIKey | BONNIAYNFCIULX-LHWSDQDFSA-N |
| XLogP | -2.72 |
| TPSA | 336.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.44 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|