C21H22N9O12P — CID 137123249
[(1R,3R,4R,5S)-3-(2-amino-6-oxo-1H-purin-9-yl)-8-hydroxy-2,6-dioxatricyclo[3.2.1.01,5]octan-4-yl] [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl hydrogen phosphate (PubChem CID 137123249) has the molecular formula C21H22N9O12P and a molecular weight of 623.43 g/mol. Its IUPAC name is [(1R,3R,4R,5S)-3-(2-amino-6-oxo-1H-purin-9-yl)-8-hydroxy-2,6-dioxatricyclo[3.2.1.01,5]octan-4-yl] [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(1R,3R,4R,5S)-3-(2-amino-6-oxo-1H-purin-9-yl)-8-hydroxy-2,6-dioxatricyclo[3.2.1.01,5]octan-4-yl] [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 137123249 |
| Molecular Formula | C21H22N9O12P |
| Molecular Weight | 623.43 g/mol |
| Exact Mass | 623.11 |
| IUPAC Name | [(1R,3R,4R,5S)-3-(2-amino-6-oxo-1H-purin-9-yl)-8-hydroxy-2,6-dioxatricyclo[3.2.1.01,5]octan-4-yl] [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@@]34CO[C@@]3(C4O)[C@H]2OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]cnc43)[C@H](O)[C@@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C21H22N9O12P/c22-19-27-13-8(15(34)28-19)26-5-30(13)17-11(21-18(35)20(21,41-17)2-38-21)42-43(36,37)39-1-6-9(31)10(32)16(40-6)29-4-25-7-12(29)23-3-24-14(7)33/h3-6,9-11,16-18,31-32,35H,1-2H2,(H,36,37)(H,23,24,33)(H3,22,27,28,34)/t6-,9-,10-,11+,16-,17-,18?,20-,21-/m1/s1 |
| InChIKey | OJTGPTMLDSKASL-FCCAQISOSA-N |
| XLogP | -3.63 |
| TPSA | 297.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.43 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|