C25H27NO6 — CID 137123633
(2R)-5-(7,8-dimethoxy-3a,9b-dimethyl-5H-isochromeno[4,3-d][1,2]oxazol-1-yl)-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-4-ol (PubChem CID 137123633) has the molecular formula C25H27NO6 and a molecular weight of 437.49 g/mol. Its IUPAC name is (2R)-5-(7,8-dimethoxy-3a,9b-dimethyl-5H-isochromeno[4,3-d][1,2]oxazol-1-yl)-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-4-ol.
| Compound Name | (2R)-5-(7,8-dimethoxy-3a,9b-dimethyl-5H-isochromeno[4,3-d][1,2]oxazol-1-yl)-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-4-ol |
|---|---|
| PubChem CID | 137123633 |
| Molecular Formula | C25H27NO6 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (2R)-5-(7,8-dimethoxy-3a,9b-dimethyl-5H-isochromeno[4,3-d][1,2]oxazol-1-yl)-2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran-4-ol |
| SMILES | C=C(C)[C@H]1Cc2c(ccc(C3=NOC4(C)OCc5cc(OC)c(OC)cc5C34C)c2O)O1 |
| InChI | InChI=1S/C25H27NO6/c1-13(2)19-10-16-18(31-19)8-7-15(22(16)27)23-24(3)17-11-21(29-6)20(28-5)9-14(17)12-30-25(24,4)32-26-23/h7-9,11,19,27H,1,10,12H2,2-6H3/t19-,24?,25?/m1/s1 |
| InChIKey | DVDCNWCKWDZSPG-PNEAOOGRSA-N |
| XLogP | 4.23 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|