C25H40N7O8P — CID 137124924
butyl (2S)-2-[[2-[(2S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxyoxolan-2-yl]ethyl-[(1-butoxy-1-oxopropan-2-ylidene)amino]phosphoryl]amino]propanoate (PubChem CID 137124924) has the molecular formula C25H40N7O8P and a molecular weight of 597.61 g/mol. Its IUPAC name is butyl (2S)-2-[[2-[(2S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxyoxolan-2-yl]ethyl-[(1-butoxy-1-oxopropan-2-ylidene)amino]phosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[2-[(2S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxyoxolan-2-yl]ethyl-[(1-butoxy-1-oxopropan-2-ylidene)amino]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 137124924 |
| Molecular Formula | C25H40N7O8P |
| Molecular Weight | 597.61 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | butyl (2S)-2-[[2-[(2S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxyoxolan-2-yl]ethyl-[(1-butoxy-1-oxopropan-2-ylidene)amino]phosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)C(C)=NP(=O)(CC[C@@H]1C[C@@H](O)[C@H](n2cnc3c(=O)[nH]c(N)nc32)O1)N[C@@H](C)C(=O)OCCCC |
| InChI | InChI=1S/C25H40N7O8P/c1-5-7-10-38-23(35)15(3)30-41(37,31-16(4)24(36)39-11-8-6-2)12-9-17-13-18(33)22(40-17)32-14-27-19-20(32)28-25(26)29-21(19)34/h14-15,17-18,22,33H,5-13H2,1-4H3,(H,30,37)(H3,26,28,29,34)/t15-,17+,18+,22+,41?/m0/s1 |
| InChIKey | BTNAYFVGRUFAIB-ZRYYOGEXSA-N |
| XLogP | 2.06 |
| TPSA | 213.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.61 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|