C17H17Cl2N3O5S — CID 137124974
2-(3,4-dichloro-N-methylsulfonylanilino)-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 137124974) has the molecular formula C17H17Cl2N3O5S and a molecular weight of 446.31 g/mol. Its IUPAC name is 2-(3,4-dichloro-N-methylsulfonylanilino)-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 137124974 |
| Molecular Formula | C17H17Cl2N3O5S |
| Molecular Weight | 446.31 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CN(c2ccc(Cl)c(Cl)c2)S(C)(=O)=O)ccc1O |
| InChI | InChI=1S/C17H17Cl2N3O5S/c1-27-16-7-11(3-6-15(16)23)9-20-21-17(24)10-22(28(2,25)26)12-4-5-13(18)14(19)8-12/h3-9,23H,10H2,1-2H3,(H,21,24)/b20-9- |
| InChIKey | UINPDLVKJQPWIF-UKWGHVSLSA-N |
| XLogP | 2.62 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|