C15H10N2O2S2 — CID 137126024
6-hydroxy-5-methyl-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-3-one (PubChem CID 137126024) has the molecular formula C15H10N2O2S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 6-hydroxy-5-methyl-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-3-one.
| Compound Name | 6-hydroxy-5-methyl-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-3-one |
|---|---|
| PubChem CID | 137126024 |
| Molecular Formula | C15H10N2O2S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 6-hydroxy-5-methyl-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-3-one |
| SMILES | Cn1c(O)c2c(c1-c1cccs1)C(=O)N=C2c1cccs1 |
| InChI | InChI=1S/C15H10N2O2S2/c1-17-13(9-5-3-7-21-9)11-10(15(17)19)12(16-14(11)18)8-4-2-6-20-8/h2-7,19H,1H3 |
| InChIKey | KOVZJJOJAVRRNN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |