C12H13BrN2O3 — CID 137128530
propyl (E)-2-[(4-bromophenyl)diazenyl]-3-hydroxyprop-2-enoate (PubChem CID 137128530) has the molecular formula C12H13BrN2O3 and a molecular weight of 313.15 g/mol. Its IUPAC name is propyl (E)-2-[(4-bromophenyl)diazenyl]-3-hydroxyprop-2-enoate.
| Compound Name | propyl (E)-2-[(4-bromophenyl)diazenyl]-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 137128530 |
| Molecular Formula | C12H13BrN2O3 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | propyl (E)-2-[(4-bromophenyl)diazenyl]-3-hydroxyprop-2-enoate |
| SMILES | CCCOC(=O)C(=C\O)/N=N/c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H13BrN2O3/c1-2-7-18-12(17)11(8-16)15-14-10-5-3-9(13)4-6-10/h3-6,8,16H,2,7H2,1H3/b11-8+,15-14+ |
| InChIKey | SVWIRKYDICLJFB-IIXCLMFLSA-N |
| XLogP | 3.89 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|