C25H27FN6O — CID 137130101
1-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-[5-(6-morpholin-4-yl-2-pyridinyl)-1H-imidazol-2-yl]prop-2-en-1-imine (PubChem CID 137130101) has the molecular formula C25H27FN6O and a molecular weight of 446.53 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-[5-(6-morpholin-4-yl-2-pyridinyl)-1H-imidazol-2-yl]prop-2-en-1-imine.
| Compound Name | 1-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-[5-(6-morpholin-4-yl-2-pyridinyl)-1H-imidazol-2-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 137130101 |
| Molecular Formula | C25H27FN6O |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 1-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-[5-(6-morpholin-4-yl-2-pyridinyl)-1H-imidazol-2-yl]prop-2-en-1-imine |
| SMILES | [H]/N=C(\C=Cc1ncc(-c2cccc(N3CCOCC3)n2)[nH]1)N1CCCC1c1cccc(F)c1 |
| InChI | InChI=1S/C25H27FN6O/c26-19-5-1-4-18(16-19)22-7-3-11-32(22)23(27)9-10-24-28-17-21(29-24)20-6-2-8-25(30-20)31-12-14-33-15-13-31/h1-2,4-6,8-10,16-17,22,27H,3,7,11-15H2,(H,28,29)/b10-9?,27-23+ |
| InChIKey | GNVHFUNYADOQBX-JHMCGVAMSA-N |
| XLogP | 4.27 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|