C31H39FN8O2 — CID 146410339
tert-butyl N-[2-[[1-[6-[2-[(Z)-3-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]-2-pyridinyl]azetidin-3-yl]amino]ethyl]carbamate (PubChem CID 146410339) has the molecular formula C31H39FN8O2 and a molecular weight of 574.71 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-[6-[2-[(Z)-3-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]-2-pyridinyl]azetidin-3-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-[6-[2-[(Z)-3-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]-2-pyridinyl]azetidin-3-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 146410339 |
| Molecular Formula | C31H39FN8O2 |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | tert-butyl N-[2-[[1-[6-[2-[(Z)-3-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]-2-pyridinyl]azetidin-3-yl]amino]ethyl]carbamate |
| SMILES | [H]/N=C(/C=C\c1ncc(-c2cccc(N3CC(NCCNC(=O)OC(C)(C)C)C3)n2)[nH]1)N1CCCC1c1cccc(F)c1 |
| InChI | InChI=1S/C31H39FN8O2/c1-31(2,3)42-30(41)35-15-14-34-23-19-39(20-23)29-11-5-9-24(38-29)25-18-36-28(37-25)13-12-27(33)40-16-6-10-26(40)21-7-4-8-22(32)17-21/h4-5,7-9,11-13,17-18,23,26,33-34H,6,10,14-16,19-20H2,1-3H3,(H,35,41)(H,36,37)/b13-12-,33-27- |
| InChIKey | HBTJVEKXWNIHKG-YKGDKHKCSA-N |
| XLogP | 4.74 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|