C27H34FN7S — CID 143894746
N-ethyl-1-[6-[2-[(Z)-3-[(2R)-2-(3-fluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]-2-pyridinyl]azetidin-3-amine;methanethiol (PubChem CID 143894746) has the molecular formula C27H34FN7S and a molecular weight of 507.68 g/mol. Its IUPAC name is N-ethyl-1-[6-[2-[(Z)-3-[(2R)-2-(3-fluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]-2-pyridinyl]azetidin-3-amine;methanethiol.
| Compound Name | N-ethyl-1-[6-[2-[(Z)-3-[(2R)-2-(3-fluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]-2-pyridinyl]azetidin-3-amine;methanethiol |
|---|---|
| PubChem CID | 143894746 |
| Molecular Formula | C27H34FN7S |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | N-ethyl-1-[6-[2-[(Z)-3-[(2R)-2-(3-fluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]-2-pyridinyl]azetidin-3-amine;methanethiol |
| SMILES | CS.[H]/N=C(/C=C\c1ncc(-c2cccc(N3CC(NCC)C3)n2)[nH]1)N1CCC[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C26H30FN7.CH4S/c1-2-29-20-16-33(17-20)26-10-4-8-21(32-26)22-15-30-25(31-22)12-11-24(28)34-13-5-9-23(34)18-6-3-7-19(27)14-18;1-2/h3-4,6-8,10-12,14-15,20,23,28-29H,2,5,9,13,16-17H2,1H3,(H,30,31);2H,1H3/b12-11-,28-24-;/t23-;/m1./s1 |
| InChIKey | RPYCKGWDDSSFCA-SWMXAHCZSA-N |
| XLogP | 4.78 |
| TPSA | 83.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|