C24H32N2O4 — CID 137138211
2-[[4-[(2R)-3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-hydroxypropoxy]phenyl]iminomethyl]-6-methoxyphenol (PubChem CID 137138211) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-[[4-[(2R)-3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-hydroxypropoxy]phenyl]iminomethyl]-6-methoxyphenol.
| Compound Name | 2-[[4-[(2R)-3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-hydroxypropoxy]phenyl]iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 137138211 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 2-[[4-[(2R)-3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-hydroxypropoxy]phenyl]iminomethyl]-6-methoxyphenol |
| SMILES | COc1cccc(/C=N/c2ccc(OC[C@H](O)CN3[C@H](C)CCC[C@H]3C)cc2)c1O |
| InChI | InChI=1S/C24H32N2O4/c1-17-6-4-7-18(2)26(17)15-21(27)16-30-22-12-10-20(11-13-22)25-14-19-8-5-9-23(29-3)24(19)28/h5,8-14,17-18,21,27-28H,4,6-7,15-16H2,1-3H3/b25-14+/t17-,18-,21-/m1/s1 |
| InChIKey | BDVWBPNTQNOQKA-JHOKEFRNSA-N |
| XLogP | 4.15 |
| TPSA | 74.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|