C23H31N2O3+ — CID 135783622
2-[[4-[(2S)-3-[(2S,6S)-2,6-dimethylpiperidin-1-ium-1-yl]-2-hydroxypropoxy]phenyl]iminomethyl]phenol (PubChem CID 135783622) has the molecular formula C23H31N2O3+ and a molecular weight of 383.51 g/mol. Its IUPAC name is 2-[[4-[(2S)-3-[(2S,6S)-2,6-dimethylpiperidin-1-ium-1-yl]-2-hydroxypropoxy]phenyl]iminomethyl]phenol.
| Compound Name | 2-[[4-[(2S)-3-[(2S,6S)-2,6-dimethylpiperidin-1-ium-1-yl]-2-hydroxypropoxy]phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135783622 |
| Molecular Formula | C23H31N2O3+ |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 2-[[4-[(2S)-3-[(2S,6S)-2,6-dimethylpiperidin-1-ium-1-yl]-2-hydroxypropoxy]phenyl]iminomethyl]phenol |
| SMILES | C[C@H]1CCC[C@H](C)[NH+]1C[C@H](O)COc1ccc(/N=C/c2ccccc2O)cc1 |
| InChI | InChI=1S/C23H30N2O3/c1-17-6-5-7-18(2)25(17)15-21(26)16-28-22-12-10-20(11-13-22)24-14-19-8-3-4-9-23(19)27/h3-4,8-14,17-18,21,26-27H,5-7,15-16H2,1-2H3/p+1/b24-14+/t17-,18-,21-/m0/s1 |
| InChIKey | CKLAPKVEJOKEHE-QHJPAULQSA-O |
| XLogP | 2.73 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|