C21H20F3N5O2 — CID 137138960
4-(dimethylamino)-N-[(Z)-[2,2,2-trifluoro-1-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)ethylidene]amino]benzamide (PubChem CID 137138960) has the molecular formula C21H20F3N5O2 and a molecular weight of 431.42 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[(Z)-[2,2,2-trifluoro-1-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)ethylidene]amino]benzamide.
| Compound Name | 4-(dimethylamino)-N-[(Z)-[2,2,2-trifluoro-1-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)ethylidene]amino]benzamide |
|---|---|
| PubChem CID | 137138960 |
| Molecular Formula | C21H20F3N5O2 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 4-(dimethylamino)-N-[(Z)-[2,2,2-trifluoro-1-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)ethylidene]amino]benzamide |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1/C(=N/NC(=O)c1ccc(N(C)C)cc1)C(F)(F)F |
| InChI | InChI=1S/C21H20F3N5O2/c1-13-17(20(31)29(27-13)16-7-5-4-6-8-16)18(21(22,23)24)25-26-19(30)14-9-11-15(12-10-14)28(2)3/h4-12,27H,1-3H3,(H,26,30)/b25-18- |
| InChIKey | BTGQJCSFZRJGCS-BWAHOGKJSA-N |
| XLogP | 3.24 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|