C30H27Cl2N3O4S — CID 137144408
(5Z)-2-(3,4-dichlorophenyl)imino-5-[[3-methoxy-4-[[4-(piperidine-1-carbonyl)phenyl]methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137144408) has the molecular formula C30H27Cl2N3O4S and a molecular weight of 596.54 g/mol. Its IUPAC name is (5Z)-2-(3,4-dichlorophenyl)imino-5-[[3-methoxy-4-[[4-(piperidine-1-carbonyl)phenyl]methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(3,4-dichlorophenyl)imino-5-[[3-methoxy-4-[[4-(piperidine-1-carbonyl)phenyl]methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137144408 |
| Molecular Formula | C30H27Cl2N3O4S |
| Molecular Weight | 596.54 g/mol |
| Exact Mass | 595.11 |
| IUPAC Name | (5Z)-2-(3,4-dichlorophenyl)imino-5-[[3-methoxy-4-[[4-(piperidine-1-carbonyl)phenyl]methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2\S/C(=N/c3ccc(Cl)c(Cl)c3)NC2=O)ccc1OCc1ccc(C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C30H27Cl2N3O4S/c1-38-26-15-20(16-27-28(36)34-30(40-27)33-22-10-11-23(31)24(32)17-22)7-12-25(26)39-18-19-5-8-21(9-6-19)29(37)35-13-3-2-4-14-35/h5-12,15-17H,2-4,13-14,18H2,1H3,(H,33,34,36)/b27-16- |
| InChIKey | UKUUSJJBHBTSSE-YUMHPJSZSA-N |
| XLogP | 7.10 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.54 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|