C20H29N5O5 — CID 137148797
N-[9-[(2R,3R)-4-butoxy-3-(1-methylcyclopropyl)oxyoxetan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide (PubChem CID 137148797) has the molecular formula C20H29N5O5 and a molecular weight of 419.48 g/mol. Its IUPAC name is N-[9-[(2R,3R)-4-butoxy-3-(1-methylcyclopropyl)oxyoxetan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(2R,3R)-4-butoxy-3-(1-methylcyclopropyl)oxyoxetan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 137148797 |
| Molecular Formula | C20H29N5O5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-[9-[(2R,3R)-4-butoxy-3-(1-methylcyclopropyl)oxyoxetan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
| SMILES | CCCCOC1O[C@@H](n2cnc3c(=O)[nH]c(NC(=O)C(C)C)nc32)[C@H]1OC1(C)CC1 |
| InChI | InChI=1S/C20H29N5O5/c1-5-6-9-28-18-13(30-20(4)7-8-20)17(29-18)25-10-21-12-14(25)22-19(24-16(12)27)23-15(26)11(2)3/h10-11,13,17-18H,5-9H2,1-4H3,(H2,22,23,24,26,27)/t13-,17-,18?/m1/s1 |
| InChIKey | ULUICXWVKRFMFR-WROHLXEZSA-N |
| XLogP | 2.32 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|