C21H24N9O8P — CID 137149449
2-amino-9-[(4S,6R,8S,13R,14R)-11-hydroxy-11-oxo-6-(6-oxo-1H-purin-9-yl)-7,10,12,15-tetraoxa-11λ5-phosphatricyclo[11.2.1.04,8]hexadecan-14-yl]-1H-purin-6-one (PubChem CID 137149449) has the molecular formula C21H24N9O8P and a molecular weight of 561.45 g/mol. Its IUPAC name is 2-amino-9-[(4S,6R,8S,13R,14R)-11-hydroxy-11-oxo-6-(6-oxo-1H-purin-9-yl)-7,10,12,15-tetraoxa-11λ5-phosphatricyclo[11.2.1.04,8]hexadecan-14-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(4S,6R,8S,13R,14R)-11-hydroxy-11-oxo-6-(6-oxo-1H-purin-9-yl)-7,10,12,15-tetraoxa-11λ5-phosphatricyclo[11.2.1.04,8]hexadecan-14-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137149449 |
| Molecular Formula | C21H24N9O8P |
| Molecular Weight | 561.45 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | 2-amino-9-[(4S,6R,8S,13R,14R)-11-hydroxy-11-oxo-6-(6-oxo-1H-purin-9-yl)-7,10,12,15-tetraoxa-11λ5-phosphatricyclo[11.2.1.04,8]hexadecan-14-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@@H]2OC3CC[C@H]4C[C@H](n5cnc6c(=O)[nH]cnc65)O[C@@H]4COP(=O)(O)O[C@@H]2C3)c(=O)[nH]1 |
| InChI | InChI=1S/C21H24N9O8P/c22-21-27-17-15(19(32)28-21)26-8-30(17)20-11-4-10(36-20)2-1-9-3-13(37-12(9)5-35-39(33,34)38-11)29-7-25-14-16(29)23-6-24-18(14)31/h6-13,20H,1-5H2,(H,33,34)(H,23,24,31)(H3,22,27,28,32)/t9-,10?,11+,12+,13+,20+/m0/s1 |
| InChIKey | GVTLQCBXSIQRMR-ZXLRYFNESA-N |
| XLogP | 0.32 |
| TPSA | 227.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.45 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|