C21H24N8O11P2 — CID 137292819
9-[(1S,6S,10S,15R)-3,12-dihydroxy-3,12-dioxo-17-(6-oxo-1H-purin-9-yl)-2,4,7,13,16-pentaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-8-yl]-1H-purin-6-one (PubChem CID 137292819) has the molecular formula C21H24N8O11P2 and a molecular weight of 626.42 g/mol. Its IUPAC name is 9-[(1S,6S,10S,15R)-3,12-dihydroxy-3,12-dioxo-17-(6-oxo-1H-purin-9-yl)-2,4,7,13,16-pentaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-8-yl]-1H-purin-6-one.
| Compound Name | 9-[(1S,6S,10S,15R)-3,12-dihydroxy-3,12-dioxo-17-(6-oxo-1H-purin-9-yl)-2,4,7,13,16-pentaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-8-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137292819 |
| Molecular Formula | C21H24N8O11P2 |
| Molecular Weight | 626.42 g/mol |
| Exact Mass | 626.10 |
| IUPAC Name | 9-[(1S,6S,10S,15R)-3,12-dihydroxy-3,12-dioxo-17-(6-oxo-1H-purin-9-yl)-2,4,7,13,16-pentaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-8-yl]-1H-purin-6-one |
| SMILES | O=c1[nH]cnc2c1ncn2C1C[C@@H]2CP(=O)(O)OC[C@H]3OC(n4cnc5c(=O)[nH]cnc54)C[C@@H]3OP(=O)(O)OC[C@H]2O1 |
| InChI | InChI=1S/C21H24N8O11P2/c30-20-16-18(22-6-24-20)28(8-26-16)14-1-10-5-41(32,33)36-4-13-11(40-42(34,35)37-3-12(10)38-14)2-15(39-13)29-9-27-17-19(29)23-7-25-21(17)31/h6-15H,1-5H2,(H,32,33)(H,34,35)(H,22,24,30)(H,23,25,31)/t10-,11+,12-,13-,14?,15?/m1/s1 |
| InChIKey | SRSXNGQSHJYUFP-KMGHYOBBSA-N |
| XLogP | 0.16 |
| TPSA | 247.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.42 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|