C20H22N9O11P — CID 137149351
2-amino-9-[(5R,7R)-12,17-dihydroxy-12-oxo-7-(6-oxo-1H-purin-9-yl)-2,4,8,11,13,16-hexaoxa-12λ5-phosphatricyclo[12.2.1.05,9]heptadecan-15-yl]-1H-purin-6-one (PubChem CID 137149351) has the molecular formula C20H22N9O11P and a molecular weight of 595.42 g/mol. Its IUPAC name is 2-amino-9-[(5R,7R)-12,17-dihydroxy-12-oxo-7-(6-oxo-1H-purin-9-yl)-2,4,8,11,13,16-hexaoxa-12λ5-phosphatricyclo[12.2.1.05,9]heptadecan-15-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(5R,7R)-12,17-dihydroxy-12-oxo-7-(6-oxo-1H-purin-9-yl)-2,4,8,11,13,16-hexaoxa-12λ5-phosphatricyclo[12.2.1.05,9]heptadecan-15-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137149351 |
| Molecular Formula | C20H22N9O11P |
| Molecular Weight | 595.42 g/mol |
| Exact Mass | 595.12 |
| IUPAC Name | 2-amino-9-[(5R,7R)-12,17-dihydroxy-12-oxo-7-(6-oxo-1H-purin-9-yl)-2,4,8,11,13,16-hexaoxa-12λ5-phosphatricyclo[12.2.1.05,9]heptadecan-15-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2C2OC3OCO[C@@H]4C[C@H](n5cnc6c(=O)[nH]cnc65)OC4COP(=O)(O)OC2C3O)c(=O)[nH]1 |
| InChI | InChI=1S/C20H22N9O11P/c21-20-26-15-11(17(32)27-20)25-5-29(15)18-13-12(30)19(39-18)36-6-35-7-1-9(38-8(7)2-37-41(33,34)40-13)28-4-24-10-14(28)22-3-23-16(10)31/h3-5,7-9,12-13,18-19,30H,1-2,6H2,(H,33,34)(H,22,23,31)(H3,21,26,27,32)/t7-,8?,9-,12?,13?,18?,19?/m1/s1 |
| InChIKey | NBUCRPLVHMEVBX-UIWFDPRPSA-N |
| XLogP | -1.79 |
| TPSA | 266.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.42 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|