C20H22ClN9O10P2 — CID 138751048
9-[(1S,10S)-17-(6-amino-2-chloropurin-9-yl)-3,12-dihydroxy-12-oxo-2,4,7,11,13,16-hexaoxa-3,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-8-yl]-1H-purin-6-one (PubChem CID 138751048) has the molecular formula C20H22ClN9O10P2 and a molecular weight of 645.85 g/mol. Its IUPAC name is 9-[(1S,10S)-17-(6-amino-2-chloropurin-9-yl)-3,12-dihydroxy-12-oxo-2,4,7,11,13,16-hexaoxa-3,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-8-yl]-1H-purin-6-one.
| Compound Name | 9-[(1S,10S)-17-(6-amino-2-chloropurin-9-yl)-3,12-dihydroxy-12-oxo-2,4,7,11,13,16-hexaoxa-3,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-8-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 138751048 |
| Molecular Formula | C20H22ClN9O10P2 |
| Molecular Weight | 645.85 g/mol |
| Exact Mass | 645.07 |
| IUPAC Name | 9-[(1S,10S)-17-(6-amino-2-chloropurin-9-yl)-3,12-dihydroxy-12-oxo-2,4,7,11,13,16-hexaoxa-3,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-8-yl]-1H-purin-6-one |
| SMILES | Nc1nc(Cl)nc2c1ncn2C1C[C@@H]2OP(O)OCC3OC(n4cnc5c(=O)[nH]cnc54)C[C@@H]3OP(=O)(O)OCC2O1 |
| InChI | InChI=1S/C20H22ClN9O10P2/c21-20-27-16(22)14-18(28-20)30(6-25-14)12-1-8-11(38-12)4-36-42(33,34)40-9-2-13(37-10(9)3-35-41(32)39-8)29-7-26-15-17(29)23-5-24-19(15)31/h5-13,32H,1-4H2,(H,33,34)(H2,22,27,28)(H,23,24,31)/t8-,9-,10?,11?,12?,13?,41?/m0/s1 |
| InChIKey | RZENNBVJFTZZBO-CPUGHMKASA-N |
| XLogP | 0.91 |
| TPSA | 246.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.85 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|