C22H27F3N4O2 — CID 137150212
[(2R)-2-ethylpiperidin-1-yl]-[(5R,7S)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanone (PubChem CID 137150212) has the molecular formula C22H27F3N4O2 and a molecular weight of 436.48 g/mol. Its IUPAC name is [(2R)-2-ethylpiperidin-1-yl]-[(5R,7S)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanone.
| Compound Name | [(2R)-2-ethylpiperidin-1-yl]-[(5R,7S)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanone |
|---|---|
| PubChem CID | 137150212 |
| Molecular Formula | C22H27F3N4O2 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | [(2R)-2-ethylpiperidin-1-yl]-[(5R,7S)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanone |
| SMILES | CC[C@@H]1CCCCN1C(=O)c1cnn2c1N[C@@H](c1ccc(OC)cc1)C[C@H]2C(F)(F)F |
| InChI | InChI=1S/C22H27F3N4O2/c1-3-15-6-4-5-11-28(15)21(30)17-13-26-29-19(22(23,24)25)12-18(27-20(17)29)14-7-9-16(31-2)10-8-14/h7-10,13,15,18-19,27H,3-6,11-12H2,1-2H3/t15-,18-,19+/m1/s1 |
| InChIKey | HUAPZXHZEINKAL-LZQZEXGQSA-N |
| XLogP | 4.96 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |