C25H19Cl2N3 — CID 137151084
6-chloro-3-[1-[(4-chlorophenyl)methyl]-4-phenylpyrazol-5-yl]-2-methyl-1H-indole (PubChem CID 137151084) has the molecular formula C25H19Cl2N3 and a molecular weight of 432.35 g/mol. Its IUPAC name is 6-chloro-3-[1-[(4-chlorophenyl)methyl]-4-phenylpyrazol-5-yl]-2-methyl-1H-indole.
| Compound Name | 6-chloro-3-[1-[(4-chlorophenyl)methyl]-4-phenylpyrazol-5-yl]-2-methyl-1H-indole |
|---|---|
| PubChem CID | 137151084 |
| Molecular Formula | C25H19Cl2N3 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 6-chloro-3-[1-[(4-chlorophenyl)methyl]-4-phenylpyrazol-5-yl]-2-methyl-1H-indole |
| SMILES | Cc1[nH]c2cc(Cl)ccc2c1-c1c(-c2ccccc2)cnn1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H19Cl2N3/c1-16-24(21-12-11-20(27)13-23(21)29-16)25-22(18-5-3-2-4-6-18)14-28-30(25)15-17-7-9-19(26)10-8-17/h2-14,29H,15H2,1H3 |
| InChIKey | DCHVFPCYTNEKAO-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |