C12H8ClF4N3O — CID 137151599
2-amino-5-[(4-chloro-3-fluorophenyl)methyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 137151599) has the molecular formula C12H8ClF4N3O and a molecular weight of 321.66 g/mol. Its IUPAC name is 2-amino-5-[(4-chloro-3-fluorophenyl)methyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-amino-5-[(4-chloro-3-fluorophenyl)methyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137151599 |
| Molecular Formula | C12H8ClF4N3O |
| Molecular Weight | 321.66 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 2-amino-5-[(4-chloro-3-fluorophenyl)methyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | Nc1nc(C(F)(F)F)c(Cc2ccc(Cl)c(F)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H8ClF4N3O/c13-7-2-1-5(4-8(7)14)3-6-9(12(15,16)17)19-11(18)20-10(6)21/h1-2,4H,3H2,(H3,18,19,20,21) |
| InChIKey | DJGFOFCYILVZJM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.66 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |