C17H11Cl2N3O3 — CID 137152670
3-chloro-N-[5-(2-chloro-4,5-dihydroxyphenyl)-2-pyridinyl]pyridine-4-carboxamide (PubChem CID 137152670) has the molecular formula C17H11Cl2N3O3 and a molecular weight of 376.20 g/mol. Its IUPAC name is 3-chloro-N-[5-(2-chloro-4,5-dihydroxyphenyl)-2-pyridinyl]pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-[5-(2-chloro-4,5-dihydroxyphenyl)-2-pyridinyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 137152670 |
| Molecular Formula | C17H11Cl2N3O3 |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 3-chloro-N-[5-(2-chloro-4,5-dihydroxyphenyl)-2-pyridinyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(-c2cc(O)c(O)cc2Cl)cn1)c1ccncc1Cl |
| InChI | InChI=1S/C17H11Cl2N3O3/c18-12-6-15(24)14(23)5-11(12)9-1-2-16(21-7-9)22-17(25)10-3-4-20-8-13(10)19/h1-8,23-24H,(H,21,22,25) |
| InChIKey | BDTOILSQNMTSIH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|