C19H19N3O2 — CID 137154860
2-(3-piperidin-1-ylquinoxalin-6-yl)benzene-1,4-diol (PubChem CID 137154860) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-(3-piperidin-1-ylquinoxalin-6-yl)benzene-1,4-diol.
| Compound Name | 2-(3-piperidin-1-ylquinoxalin-6-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 137154860 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-(3-piperidin-1-ylquinoxalin-6-yl)benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(-c2ccc3ncc(N4CCCCC4)nc3c2)c1 |
| InChI | InChI=1S/C19H19N3O2/c23-14-5-7-18(24)15(11-14)13-4-6-16-17(10-13)21-19(12-20-16)22-8-2-1-3-9-22/h4-7,10-12,23-24H,1-3,8-9H2 |
| InChIKey | CKPQMPGMRKGIDO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|