C41H42N8O3 — CID 174665442
2,4-bis[4-[7-(4-hydroxyphenyl)quinoxalin-2-yl]piperazin-1-yl]pentan-3-one (PubChem CID 174665442) has the molecular formula C41H42N8O3 and a molecular weight of 694.84 g/mol. Its IUPAC name is 2,4-bis[4-[7-(4-hydroxyphenyl)quinoxalin-2-yl]piperazin-1-yl]pentan-3-one.
| Compound Name | 2,4-bis[4-[7-(4-hydroxyphenyl)quinoxalin-2-yl]piperazin-1-yl]pentan-3-one |
|---|---|
| PubChem CID | 174665442 |
| Molecular Formula | C41H42N8O3 |
| Molecular Weight | 694.84 g/mol |
| Exact Mass | 694.34 |
| IUPAC Name | 2,4-bis[4-[7-(4-hydroxyphenyl)quinoxalin-2-yl]piperazin-1-yl]pentan-3-one |
| SMILES | CC(C(=O)C(C)N1CCN(c2cnc3ccc(-c4ccc(O)cc4)cc3n2)CC1)N1CCN(c2cnc3ccc(-c4ccc(O)cc4)cc3n2)CC1 |
| InChI | InChI=1S/C41H42N8O3/c1-27(46-15-19-48(20-16-46)39-25-42-35-13-7-31(23-37(35)44-39)29-3-9-33(50)10-4-29)41(52)28(2)47-17-21-49(22-18-47)40-26-43-36-14-8-32(24-38(36)45-40)30-5-11-34(51)12-6-30/h3-14,23-28,50-51H,15-22H2,1-2H3 |
| InChIKey | ZXKKRWQQULPSKO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.84 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |