C27H35N3O — CID 137155823
4-[1-[2-ethyl-5-(3-methoxyphenyl)-1H-pyrrol-3-yl]ethylideneamino]-N,N-dipropylaniline (PubChem CID 137155823) has the molecular formula C27H35N3O and a molecular weight of 417.60 g/mol. Its IUPAC name is 4-[1-[2-ethyl-5-(3-methoxyphenyl)-1H-pyrrol-3-yl]ethylideneamino]-N,N-dipropylaniline.
| Compound Name | 4-[1-[2-ethyl-5-(3-methoxyphenyl)-1H-pyrrol-3-yl]ethylideneamino]-N,N-dipropylaniline |
|---|---|
| PubChem CID | 137155823 |
| Molecular Formula | C27H35N3O |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | 4-[1-[2-ethyl-5-(3-methoxyphenyl)-1H-pyrrol-3-yl]ethylideneamino]-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1ccc(/N=C(\C)c2cc(-c3cccc(OC)c3)[nH]c2CC)cc1 |
| InChI | InChI=1S/C27H35N3O/c1-6-16-30(17-7-2)23-14-12-22(13-15-23)28-20(4)25-19-27(29-26(25)8-3)21-10-9-11-24(18-21)31-5/h9-15,18-19,29H,6-8,16-17H2,1-5H3/b28-20+ |
| InChIKey | MHGYPNIJQRFQRB-VFCFBJKWSA-N |
| XLogP | 7.02 |
| TPSA | 40.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|