C24H23F3N4O4S — CID 137155961
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 137155961) has the molecular formula C24H23F3N4O4S and a molecular weight of 520.53 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 137155961 |
| Molecular Formula | C24H23F3N4O4S |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] N-(3,4-dimethylphenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | Cc1ccc(/N=C(\SCC(=O)Nc2ccccc2C(F)(F)F)c2c(O)n(C)c(=O)n(C)c2=O)cc1C |
| InChI | InChI=1S/C24H23F3N4O4S/c1-13-9-10-15(11-14(13)2)28-20(19-21(33)30(3)23(35)31(4)22(19)34)36-12-18(32)29-17-8-6-5-7-16(17)24(25,26)27/h5-11,33H,12H2,1-4H3,(H,29,32)/b28-20- |
| InChIKey | CBSDETXBIXMMSV-RRAHZORUSA-N |
| XLogP | 3.88 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|