C10H18N2O4S — CID 137157047
2-ethylimino-5-(hydroxymethyl)-7-methoxy-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-6-ol (PubChem CID 137157047) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is 2-ethylimino-5-(hydroxymethyl)-7-methoxy-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-6-ol.
| Compound Name | 2-ethylimino-5-(hydroxymethyl)-7-methoxy-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-6-ol |
|---|---|
| PubChem CID | 137157047 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-ethylimino-5-(hydroxymethyl)-7-methoxy-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-6-ol |
| SMILES | CC/N=C1/NC2C(OC(CO)C(O)C2OC)S1 |
| InChI | InChI=1S/C10H18N2O4S/c1-3-11-10-12-6-8(15-2)7(14)5(4-13)16-9(6)17-10/h5-9,13-14H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | JRZSXVZVOPYSIU-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|