C15H22N2O7S — CID 135907982
[(5R,6S,7R)-6,7-diacetyloxy-2-ethylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate (PubChem CID 135907982) has the molecular formula C15H22N2O7S and a molecular weight of 374.42 g/mol. Its IUPAC name is [(5R,6S,7R)-6,7-diacetyloxy-2-ethylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate.
| Compound Name | [(5R,6S,7R)-6,7-diacetyloxy-2-ethylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 135907982 |
| Molecular Formula | C15H22N2O7S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | [(5R,6S,7R)-6,7-diacetyloxy-2-ethylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate |
| SMILES | CC/N=C1/NC2C(O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O)S1 |
| InChI | InChI=1S/C15H22N2O7S/c1-5-16-15-17-11-13(23-9(4)20)12(22-8(3)19)10(6-21-7(2)18)24-14(11)25-15/h10-14H,5-6H2,1-4H3,(H,16,17)/t10-,11?,12-,13-,14?/m1/s1 |
| InChIKey | FMXKWKMYEAHACV-LYPMUSHJSA-N |
| XLogP | 0.22 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|