C22H28N2O8S — CID 137092517
[6,7-diacetyloxy-2-(2-phenylmethoxyethylimino)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate (PubChem CID 137092517) has the molecular formula C22H28N2O8S and a molecular weight of 480.54 g/mol. Its IUPAC name is [6,7-diacetyloxy-2-(2-phenylmethoxyethylimino)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate.
| Compound Name | [6,7-diacetyloxy-2-(2-phenylmethoxyethylimino)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 137092517 |
| Molecular Formula | C22H28N2O8S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | [6,7-diacetyloxy-2-(2-phenylmethoxyethylimino)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-5-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC2S/C(=N\CCOCc3ccccc3)NC2C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C22H28N2O8S/c1-13(25)29-12-17-19(30-14(2)26)20(31-15(3)27)18-21(32-17)33-22(24-18)23-9-10-28-11-16-7-5-4-6-8-16/h4-8,17-21H,9-12H2,1-3H3,(H,23,24) |
| InChIKey | CQRLMZHICDHJDZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 121.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|