C21H23NO6 — CID 137159139
2-methoxyethyl 2-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]acetate (PubChem CID 137159139) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-methoxyethyl 2-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]acetate.
| Compound Name | 2-methoxyethyl 2-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]acetate |
|---|---|
| PubChem CID | 137159139 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 2-methoxyethyl 2-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]acetate |
| SMILES | COCCOC(=O)Cc1cccc(/C=C/C(=O)c2c(O)cc(C)n(C)c2=O)c1 |
| InChI | InChI=1S/C21H23NO6/c1-14-11-18(24)20(21(26)22(14)2)17(23)8-7-15-5-4-6-16(12-15)13-19(25)28-10-9-27-3/h4-8,11-12,24H,9-10,13H2,1-3H3/b8-7+ |
| InChIKey | BILWHDVYCXQKHJ-BQYQJAHWSA-N |
| XLogP | 2.03 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|