About (4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium
(4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium (PubChem CID 137161393) has the molecular formula C7H13N4+
and a molecular weight of 153.21 g/mol. Its IUPAC name is (4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium.
Molecular Properties
| Compound Name | (4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium |
| PubChem CID | 137161393 |
| Molecular Formula | C7H13N4+ |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.11 |
| IUPAC Name | (4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium |
| SMILES | CC=[N+](C)C1=CC(N)=NCN1 |
| InChI | InChI=1S/C7H13N4/c1-3-11(2)7-4-6(8)9-5-10-7/h3-4,10H,5H2,1-2H3,(H2,8,9)/q+1 |
| InChIKey | FBESCBXDVDOTMV-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 53.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium?
The IUPAC name of (4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium (CID 137161393) is (4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium.
What is the SMILES notation for (4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium?
The canonical SMILES for (4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium is CC=[N+](C)C1=CC(N)=NCN1.
What is the InChIKey of (4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium?
The InChIKey is FBESCBXDVDOTMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N4/c1-3-11(2)7-4-6(8)9-5-10-7/h3-4,10H,5H2,1-2H3,(H2,8,9)/q+1.
What are the key properties of (4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium?
(4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium has a molecular weight of 153.21 g/mol, XLogP of -0.52, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium is sourced from PubChem (CID 137161393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).