C7H13N4+ — CID 137161393
(4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium (PubChem CID 137161393) has the molecular formula C7H13N4+ and a molecular weight of 153.21 g/mol. Its IUPAC name is (4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium.
| Compound Name | (4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium |
|---|---|
| PubChem CID | 137161393 |
| Molecular Formula | C7H13N4+ |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.11 |
| IUPAC Name | (4-amino-1,2-dihydropyrimidin-6-yl)-ethylidene-methylazanium |
| SMILES | CC=[N+](C)C1=CC(N)=NCN1 |
| InChI | InChI=1S/C7H13N4/c1-3-11(2)7-4-6(8)9-5-10-7/h3-4,10H,5H2,1-2H3,(H2,8,9)/q+1 |
| InChIKey | FBESCBXDVDOTMV-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 53.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|