C7H12N4 — CID 171384781
N,3-dimethyl-2-methyliminopyrimidin-4-amine (PubChem CID 171384781) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is N,3-dimethyl-2-methyliminopyrimidin-4-amine.
| Compound Name | N,3-dimethyl-2-methyliminopyrimidin-4-amine |
|---|---|
| PubChem CID | 171384781 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | N,3-dimethyl-2-methyliminopyrimidin-4-amine |
| SMILES | C/N=c1\nccc(NC)n1C |
| InChI | InChI=1S/C7H12N4/c1-8-6-4-5-10-7(9-2)11(6)3/h4-5,8H,1-3H3/b9-7+ |
| InChIKey | QLPXYYJPECRARH-VQHVLOKHSA-N |
| XLogP | -0.01 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |