About 3-(1H-indol-3-yl)-1,2-oxazole-5-carbonitrile
3-(1H-indol-3-yl)-1,2-oxazole-5-carbonitrile (PubChem CID 137166423) has the molecular formula C12H7N3O
and a molecular weight of 209.21 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-1,2-oxazole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-(1H-indol-3-yl)-1,2-oxazole-5-carbonitrile |
| PubChem CID | 137166423 |
| Molecular Formula | C12H7N3O |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 3-(1H-indol-3-yl)-1,2-oxazole-5-carbonitrile |
| SMILES | N#Cc1cc(-c2c[nH]c3ccccc23)no1 |
| InChI | InChI=1S/C12H7N3O/c13-6-8-5-12(15-16-8)10-7-14-11-4-2-1-3-9(10)11/h1-5,7,14H |
| InChIKey | MGGZPNGEXKFLLJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1H-indol-3-yl)-1,2-oxazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-indol-3-yl)-1,2-oxazole-5-carbonitrile?
The IUPAC name of 3-(1H-indol-3-yl)-1,2-oxazole-5-carbonitrile (CID 137166423) is 3-(1H-indol-3-yl)-1,2-oxazole-5-carbonitrile.
What is the SMILES notation for 3-(1H-indol-3-yl)-1,2-oxazole-5-carbonitrile?
The canonical SMILES for 3-(1H-indol-3-yl)-1,2-oxazole-5-carbonitrile is N#Cc1cc(-c2c[nH]c3ccccc23)no1.
What is the InChIKey of 3-(1H-indol-3-yl)-1,2-oxazole-5-carbonitrile?
The InChIKey is MGGZPNGEXKFLLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3O/c13-6-8-5-12(15-16-8)10-7-14-11-4-2-1-3-9(10)11/h1-5,7,14H.
What are the key properties of 3-(1H-indol-3-yl)-1,2-oxazole-5-carbonitrile?
3-(1H-indol-3-yl)-1,2-oxazole-5-carbonitrile has a molecular weight of 209.21 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-indol-3-yl)-1,2-oxazole-5-carbonitrile is sourced from PubChem (CID 137166423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).