C15H19N3O2S — CID 137168586
2-methyl-4-[(3S)-4-[(3-methylthiophen-2-yl)methyl]morpholin-3-yl]-1H-pyrimidin-6-one (PubChem CID 137168586) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-methyl-4-[(3S)-4-[(3-methylthiophen-2-yl)methyl]morpholin-3-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-[(3S)-4-[(3-methylthiophen-2-yl)methyl]morpholin-3-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137168586 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-methyl-4-[(3S)-4-[(3-methylthiophen-2-yl)methyl]morpholin-3-yl]-1H-pyrimidin-6-one |
| SMILES | Cc1nc([C@H]2COCCN2Cc2sccc2C)cc(=O)[nH]1 |
| InChI | InChI=1S/C15H19N3O2S/c1-10-3-6-21-14(10)8-18-4-5-20-9-13(18)12-7-15(19)17-11(2)16-12/h3,6-7,13H,4-5,8-9H2,1-2H3,(H,16,17,19)/t13-/m1/s1 |
| InChIKey | JAZWHUBSQIXAFT-CYBMUJFWSA-N |
| XLogP | 2.02 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |