C15H17FN4O2 — CID 137052983
4-[(3R)-4-[(3-fluoro-2-pyridinyl)methyl]morpholin-3-yl]-2-methyl-1H-pyrimidin-6-one (PubChem CID 137052983) has the molecular formula C15H17FN4O2 and a molecular weight of 304.32 g/mol. Its IUPAC name is 4-[(3R)-4-[(3-fluoro-2-pyridinyl)methyl]morpholin-3-yl]-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-[(3R)-4-[(3-fluoro-2-pyridinyl)methyl]morpholin-3-yl]-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137052983 |
| Molecular Formula | C15H17FN4O2 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-[(3R)-4-[(3-fluoro-2-pyridinyl)methyl]morpholin-3-yl]-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc([C@@H]2COCCN2Cc2ncccc2F)cc(=O)[nH]1 |
| InChI | InChI=1S/C15H17FN4O2/c1-10-18-12(7-15(21)19-10)14-9-22-6-5-20(14)8-13-11(16)3-2-4-17-13/h2-4,7,14H,5-6,8-9H2,1H3,(H,18,19,21)/t14-/m0/s1 |
| InChIKey | OMFIHDVIBCDELU-AWEZNQCLSA-N |
| XLogP | 1.19 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |