C18H17ClN4O — CID 137168649
4-chloro-2-[(5R,7S)-7-(4-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]phenol (PubChem CID 137168649) has the molecular formula C18H17ClN4O and a molecular weight of 340.81 g/mol. Its IUPAC name is 4-chloro-2-[(5R,7S)-7-(4-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]phenol.
| Compound Name | 4-chloro-2-[(5R,7S)-7-(4-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]phenol |
|---|---|
| PubChem CID | 137168649 |
| Molecular Formula | C18H17ClN4O |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 4-chloro-2-[(5R,7S)-7-(4-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]phenol |
| SMILES | Cc1ccc([C@@H]2C[C@H](c3cc(Cl)ccc3O)Nc3ncnn32)cc1 |
| InChI | InChI=1S/C18H17ClN4O/c1-11-2-4-12(5-3-11)16-9-15(22-18-20-10-21-23(16)18)14-8-13(19)6-7-17(14)24/h2-8,10,15-16,24H,9H2,1H3,(H,20,21,22)/t15-,16+/m1/s1 |
| InChIKey | RLXRSACLVHZKNS-CVEARBPZSA-N |
| XLogP | 4.09 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|