C18H16Cl2N4S — CID 137168762
(5R,7S)-7-(2,4-dichlorophenyl)-2-methylsulfanyl-5-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 137168762) has the molecular formula C18H16Cl2N4S and a molecular weight of 391.33 g/mol. Its IUPAC name is (5R,7S)-7-(2,4-dichlorophenyl)-2-methylsulfanyl-5-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | (5R,7S)-7-(2,4-dichlorophenyl)-2-methylsulfanyl-5-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 137168762 |
| Molecular Formula | C18H16Cl2N4S |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | (5R,7S)-7-(2,4-dichlorophenyl)-2-methylsulfanyl-5-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CSc1nc2n(n1)[C@H](c1ccc(Cl)cc1Cl)C[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C18H16Cl2N4S/c1-25-18-22-17-21-15(11-5-3-2-4-6-11)10-16(24(17)23-18)13-8-7-12(19)9-14(13)20/h2-9,15-16H,10H2,1H3,(H,21,22,23)/t15-,16+/m1/s1 |
| InChIKey | DCQWBGLMHHVSJT-CVEARBPZSA-N |
| XLogP | 5.45 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |