C18H21N5O4 — CID 137174972
(2R,4R)-4-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]triazol-1-yl]-1-(2-phenylethyl)pyrrolidine-2-carboxylic acid (PubChem CID 137174972) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is (2R,4R)-4-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]triazol-1-yl]-1-(2-phenylethyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4R)-4-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]triazol-1-yl]-1-(2-phenylethyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 137174972 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | (2R,4R)-4-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]triazol-1-yl]-1-(2-phenylethyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(/C=C/c1cn([C@@H]2C[C@H](C(=O)O)N(CCc3ccccc3)C2)nn1)NO |
| InChI | InChI=1S/C18H21N5O4/c24-17(20-27)7-6-14-11-23(21-19-14)15-10-16(18(25)26)22(12-15)9-8-13-4-2-1-3-5-13/h1-7,11,15-16,27H,8-10,12H2,(H,20,24)(H,25,26)/b7-6+/t15-,16-/m1/s1 |
| InChIKey | KFBVJPZDGIVIAX-YCZSJOHXSA-N |
| XLogP | 0.74 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|