C19H23N5O4 — CID 137174966
(2R,4S)-4-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]triazol-1-yl]-1-(3-phenylpropyl)pyrrolidine-2-carboxylic acid (PubChem CID 137174966) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is (2R,4S)-4-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]triazol-1-yl]-1-(3-phenylpropyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4S)-4-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]triazol-1-yl]-1-(3-phenylpropyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 137174966 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (2R,4S)-4-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]triazol-1-yl]-1-(3-phenylpropyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(/C=C/c1cn([C@H]2C[C@H](C(=O)O)N(CCCc3ccccc3)C2)nn1)NO |
| InChI | InChI=1S/C19H23N5O4/c25-18(21-28)9-8-15-12-24(22-20-15)16-11-17(19(26)27)23(13-16)10-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-9,12,16-17,28H,4,7,10-11,13H2,(H,21,25)(H,26,27)/b9-8+/t16-,17+/m0/s1 |
| InChIKey | CBHBWPLADYZHRS-IBHATUTGSA-N |
| XLogP | 1.13 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|