C19H25N5O3 — CID 137225105
(E)-N-hydroxy-3-[1-[(3S,5R)-5-(hydroxymethyl)-1-(3-phenylpropyl)pyrrolidin-3-yl]triazol-4-yl]prop-2-enamide (PubChem CID 137225105) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[1-[(3S,5R)-5-(hydroxymethyl)-1-(3-phenylpropyl)pyrrolidin-3-yl]triazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[1-[(3S,5R)-5-(hydroxymethyl)-1-(3-phenylpropyl)pyrrolidin-3-yl]triazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 137225105 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | (E)-N-hydroxy-3-[1-[(3S,5R)-5-(hydroxymethyl)-1-(3-phenylpropyl)pyrrolidin-3-yl]triazol-4-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cn([C@H]2C[C@H](CO)N(CCCc3ccccc3)C2)nn1)NO |
| InChI | InChI=1S/C19H25N5O3/c25-14-18-11-17(24-12-16(20-22-24)8-9-19(26)21-27)13-23(18)10-4-7-15-5-2-1-3-6-15/h1-3,5-6,8-9,12,17-18,25,27H,4,7,10-11,13-14H2,(H,21,26)/b9-8+/t17-,18+/m0/s1 |
| InChIKey | GRQQRUSTYHTSNU-CWDJHMJFSA-N |
| XLogP | 1.04 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|